Online Database of Chemicals from Around the World
|
CAS#: 150993-72-9 Product: 2'-C-Methyl-5'-O-[(phosphonatooxy)phosphinato]adenosine No suppilers available for the product. |
| Name | 2'-C-Methyl-5'-O-[(phosphonatooxy)phosphinato]adenosine |
|---|---|
| Synonyms | 2'C-methyladenosine 5'-diphosphate |
| Molecular Structure | ![CAS#: 150993-72-9, 2'-C-Methyl-5'-O-[(phosphonatooxy)phosphinato]adenosine](/moreStructures/150993-72-9.gif) |
| Molecular Formula | C11H14N5O10P2 |
| Molecular Weight | 438.21 |
| CAS Registry Number | 150993-72-9 |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1n2cnc3c2ncnc3N)COP(=O)([O-])OP(=O)([O-])[O-])O)O |
| InChI | 1S/C11H17N5O10P2/c1-11(18)7(17)5(2-24-28(22,23)26-27(19,20)21)25-10(11)16-4-15-6-8(12)13-3-14-9(6)16/h3-5,7,10,17-18H,2H2,1H3,(H,22,23)(H2,12,13,14)(H2,19,20,21)/p-3/t5-,7-,10-,11-/m1/s1 |
| InChIKey | RYJCYMQAEPHSPQ-YRKGHMEHSA-K |
| Density | 2.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 847.253°C at 760 mmHg (Cal.) |
| Flash point | 466.202°C (Cal.) |
| Refractive index | 1.839 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-C-Methyl-5'-O-[(phosphonatooxy)phosphinato]adenosine |