|
CAS#: 15103-99-8 Product: Hypophosphoric Acid Tetramethyl Ester No suppilers available for the product. |
| Name | Hypophosphoric Acid Tetramethyl Ester |
|---|---|
| Synonyms | (Dimethoxyphosphoryl-Methoxy-Phosphoryl)Oxymethane; Hypophosphoric Acid, Tetramethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C4H12O6P2 |
| Molecular Weight | 218.08 |
| CAS Registry Number | 15103-99-8 |
| SMILES | CO[P]([P](OC)(OC)=O)(OC)=O |
| InChI | 1S/C4H12O6P2/c1-7-11(5,8-2)12(6,9-3)10-4/h1-4H3 |
| InChIKey | LWASJEZSIVAZJX-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 217.86°C at 760 mmHg (Cal.) |
| Flash point | 99.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hypophosphoric Acid Tetramethyl Ester |