| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | (2,5-Dichlorophenyl)(4-Phenoxyphenyl)Methanone |
|---|---|
| Synonyms | 2,5-dichlorophenyl 4-phenoxyphenyl ketone; 2,5-Dichlorophenyl-4-phenoxyphenylmethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H12Cl2O2 |
| Molecular Weight | 343.20 |
| CAS Registry Number | 151173-25-0 |
| SMILES | O=C(c1cc(Cl)ccc1Cl)c3ccc(Oc2ccccc2)cc3 |
| InChI | 1S/C19H12Cl2O2/c20-14-8-11-18(21)17(12-14)19(22)13-6-9-16(10-7-13)23-15-4-2-1-3-5-15/h1-12H |
| InChIKey | VHXNNVZZGMWSBN-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.686°C at 760 mmHg (Cal.) |
| Flash point | 182.668°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,5-Dichlorophenyl)(4-Phenoxyphenyl)Methanone |