|
CAS#: 151233-05-5 Product: Respinomycin B No suppilers available for the product. |
| Name | Respinomycin B |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C35H43NO14 |
| Molecular Weight | 701.72 |
| CAS Registry Number | 151233-05-5 |
| SMILES | C1=C7C(=C(O)C5=C1C(=O)C4=C(C2=C(C3(OC(O2)C(O)C(NC)C3O)C)C=C4)C5=O)C(OC6OC(C(O)C(O)(C6OC)C)C)C(OC)C(O)(C7)C |
| InChI | 1S/C35H43NO14/c1-12-27(41)34(3,44)30(46-7)32(47-12)49-26-17-13(11-33(2,43)29(26)45-6)10-15-18(22(17)38)23(39)19-14(21(15)37)8-9-16-25(19)48-31-24(40)20(36-5)28(42)35(16,4)50-31/h8-10,12,20,24,26-32,36,38,40-44H,11H2,1-7H3 |
| InChIKey | HXEWDKDWENRZME-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 907.061°C at 760 mmHg (Cal.) |
| Flash point | 502.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Respinomycin B |