|
CAS#: 151285-26-6 Product: 2-[{4-[(3-Cyano-5-Nitro-2-Thienyl)Diazenyl]-3-Methylphenyl}(Ethyl)Amino]Ethyl 2-Methylpropanoate No suppilers available for the product. |
| Name | 2-[{4-[(3-Cyano-5-Nitro-2-Thienyl)Diazenyl]-3-Methylphenyl}(Ethyl)Amino]Ethyl 2-Methylpropanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.49 |
| CAS Registry Number | 151285-26-6 |
| SMILES | CCN(CCOC(=O)C(C)C)c1ccc(c(c1)C)N=Nc2c(cc(s2)[N+](=O)[O-])C#N |
| InChI | 1S/C20H23N5O4S/c1-5-24(8-9-29-20(26)13(2)3)16-6-7-17(14(4)10-16)22-23-19-15(12-21)11-18(30-19)25(27)28/h6-7,10-11,13H,5,8-9H2,1-4H3 |
| InChIKey | DRNRUVFRAGTXRE-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.368°C at 760 mmHg (Cal.) |
| Flash point | 319.915°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[{4-[(3-Cyano-5-Nitro-2-Thienyl)Diazenyl]-3-Methylphenyl}(Ethyl)Amino]Ethyl 2-Methylpropanoate |