| Name | 3-Methyl-6-Nitro-4H-1,3-Benzoxazin-2-One |
|---|---|
| Synonyms | 3,4-Dihydro-3-Methyl-6-Nitro-2H-1,3-Benzoxazin-2-One; 3,4-Dmnb; 2H-1,3-Benzoxazin-2-One, 3,4-Dihydro-3-Methyl-6-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 151480-73-8 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)OC(=O)N(C2)C |
| InChI | 1S/C9H8N2O4/c1-10-5-6-4-7(11(13)14)2-3-8(6)15-9(10)12/h2-4H,5H2,1H3 |
| InChIKey | ZXTGTRLWIRCGBB-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.499°C at 760 mmHg (Cal.) |
| Flash point | 171.824°C (Cal.) |
| (1) | J. M. Waters and T. M. Kitson. 3,4-Dihydro-3-methyl-6-nitro-2H-1,3-benzoxazin-2-one and p-Nitrophenyl Dimethylcarbamate, Acta Cryst. (1996). C52, 101-104 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-6-Nitro-4H-1,3-Benzoxazin-2-One |