| ChemPacific Corp | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Methyl (2E,4E)-5-Phenyl-2,4-Pentadienoate |
|---|---|
| Synonyms | (2E,4E)-5-Phenyl-penta-2,4-dienoic; (2E,4E)-5-Phenyl-penta-2,4-dienoic; acid methyl ester; (2E,4E)-5-PHENYL-PENTA-2,4-DIENOICACIDMETHYLESTER |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.22 |
| CAS Registry Number | 1516-24-1 |
| SMILES | COC(=O)/C=C/C=C/C1=CC=CC=C1 |
| InChI | 1S/C12H12O2/c1-14-12(13)10-6-5-9-11-7-3-2-4-8-11/h2-10H,1H3/b9-5+,10-6+ |
| InChIKey | OXWQBUHCJNXFLV-NXZHAISVSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.7±21.0°C at 760 mmHg (Cal.) |
| Flash point | 187.4±13.2°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Michael E. O'Donnell, Jonathan Sanvoisin and David Gani. Serine–threonine protein phosphatase inhibitors derived from nodularin: role of the 2-methyl and 3-diene groups in the Adda residue and the effect of macrocyclic conformational restraint, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1696. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl (2E,4E)-5-Phenyl-2,4-Pentadienoate |