| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | (E)-1,1,1,2,3,4,4,4-Octafluorobut-2-Ene |
|---|---|
| Synonyms | (E)-1,1,1,2,3,4,4,4-Octafluorobut-2-Ene; Perfluoro-2-Butene, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C4F8 |
| Molecular Weight | 200.03 |
| CAS Registry Number | 1516-64-9 |
| EINECS | 216-168-5 |
| SMILES | C(/F)(=C(/F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C4F8/c5-1(3(7,8)9)2(6)4(10,11)12/b2-1- |
| InChIKey | WSJULBMCKQTTIG-UPHRSURJSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 8.312°C at 760 mmHg (Cal.) |
| Flash point | -32.935°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1,1,1,2,3,4,4,4-Octafluorobut-2-Ene |