|
CAS#: 15173-23-6 Product: (5beta,12beta)-12-Hydroxycholan-24-oic acid No suppilers available for the product. |
| Name | (5beta,12beta)-12-Hydroxycholan-24-oic acid |
|---|---|
| Synonyms | 12β-Hydroxy-5β-cholan-24-oic Acid; LMST04010016 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.57 |
| CAS Registry Number | 15173-23-6 |
| SMILES | O=C(O)CC[C@@H](C)[C@H]4CC[C@H]3[C@H]2[C@@H]([C@@]1([C@@H](CCCC1)CC2)C)C[C@@H](O)[C@@]34C |
| InChI | 1S/C24H40O3/c1-15(7-12-22(26)27)18-10-11-19-17-9-8-16-6-4-5-13-23(16,2)20(17)14-21(25)24(18,19)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16+,17+,18-,19+,20+,21-,23+,24-/m1/s1 |
| InChIKey | OBUOWZOYJNAMCZ-ORVKXXEISA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.109°C at 760 mmHg (Cal.) |
| Flash point | 276.996°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5beta,12beta)-12-Hydroxycholan-24-oic acid |