|
CAS#: 152053-09-3 Product: 2-(Dichloromethoxymethyl)-3-Hydroxy-3-(4-Nitrophenyl)Propanamide No suppilers available for the product. |
| Name | 2-(Dichloromethoxymethyl)-3-Hydroxy-3-(4-Nitrophenyl)Propanamide |
|---|---|
| Synonyms | 2-(Dichloromethoxymethyl)-3-Hydroxy-3-(4-Nitrophenyl)Propionamide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2N2O5 |
| Molecular Weight | 323.13 |
| CAS Registry Number | 152053-09-3 |
| SMILES | C1=CC(=CC=C1[N+]([O-])=O)C(C(C(=O)N)COC(Cl)Cl)O |
| InChI | 1S/C11H12Cl2N2O5/c12-11(13)20-5-8(10(14)17)9(16)6-1-3-7(4-2-6)15(18)19/h1-4,8-9,11,16H,5H2,(H2,14,17) |
| InChIKey | FHDPTOGOPLCNDA-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.519°C at 760 mmHg (Cal.) |
| Flash point | 332.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dichloromethoxymethyl)-3-Hydroxy-3-(4-Nitrophenyl)Propanamide |