|
CAS#: 152110-12-8 Product: 1-(2,6-Dihydroxyphenyl)-5-Phenylpentan-1-One No suppilers available for the product. |
| Name | 1-(2,6-Dihydroxyphenyl)-5-Phenylpentan-1-One |
|---|---|
| Synonyms | 1-(2,6-Dihydroxyphenyl)-5-Phenyl-Pentan-1-One; 1-Pentanone, 1-(2,6-Dihydroxyphenyl)-5-Phenyl-; Knerachelin B |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 |
| CAS Registry Number | 152110-12-8 |
| SMILES | C1=C(O)C(=C(O)C=C1)C(=O)CCCCC2=CC=CC=C2 |
| InChI | 1S/C17H18O3/c18-14(17-15(19)11-6-12-16(17)20)10-5-4-9-13-7-2-1-3-8-13/h1-3,6-8,11-12,19-20H,4-5,9-10H2 |
| InChIKey | MCFQVPWNIUZPJV-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.85°C at 760 mmHg (Cal.) |
| Flash point | 236.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dihydroxyphenyl)-5-Phenylpentan-1-One |