|
CAS#: 152175-75-2 Product: 1,7,9,11-Tetrahydroxy-3-Pentyl-Benzo(a)Naphthacene-8,13-Dione No suppilers available for the product. |
| Name | 1,7,9,11-Tetrahydroxy-3-Pentyl-Benzo(a)Naphthacene-8,13-Dione |
|---|---|
| Synonyms | Benzo(A)Naphthacene-8,13-Dione, 3-Pentyl-1,7,9,11-Tetrahydroxy-; Bequinostatin D; 3-Pentyl-1,7,9,11-Tetrahydroxybenzo(A)Naphthacene-8,13-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 |
| CAS Registry Number | 152175-75-2 |
| SMILES | C1=C4C(=C(O)C3=C1C2=C(O)C=C(C=C2C=C3)CCCCC)C(=O)C5=C(C4=O)C=C(O)C=C5O |
| InChI | 1S/C27H22O6/c1-2-3-4-5-13-8-14-6-7-16-17(22(14)20(29)9-13)12-19-24(26(16)32)27(33)23-18(25(19)31)10-15(28)11-21(23)30/h6-12,28-30,32H,2-5H2,1H3 |
| InChIKey | KQPKOQPRDHCAAB-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 766.798°C at 760 mmHg (Cal.) |
| Flash point | 431.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,9,11-Tetrahydroxy-3-Pentyl-Benzo(a)Naphthacene-8,13-Dione |