Online Database of Chemicals from Around the World
|
CAS#: 152406-98-9 Product: [4-(Fluoromethyl)Phenyl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [4-(Fluoromethyl)Phenyl] Dihydrogen Phosphate |
|---|---|
| Synonyms | Fmpp; Phenol, 4-(Fluoromethyl)-, Dihydrogen Phosphate; 4-(Fluoromethyl)Phenyl Phosphate |
| Molecular Structure | ![CAS#: 152406-98-9, [4-(Fluoromethyl)Phenyl] Dihydrogen Phosphate](/moreStructures/152406-98-9.gif) |
| Molecular Formula | C7H8FO4P |
| Molecular Weight | 206.11 |
| CAS Registry Number | 152406-98-9 |
| SMILES | C1=C(O[P](=O)(O)O)C=CC(=C1)CF |
| InChI | 1S/C7H8FO4P/c8-5-6-1-3-7(4-2-6)12-13(9,10)11/h1-4H,5H2,(H2,9,10,11) |
| InChIKey | BHOAQALZKIWXQV-UHFFFAOYSA-N |
| Density | 1.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.38°C at 760 mmHg (Cal.) |
| Flash point | 187.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(Fluoromethyl)Phenyl] Dihydrogen Phosphate |