|
CAS#: 152786-08-8 Product: (4S,5R)-2,2,5-Trimethyl-1,3-Dioxolane-4-Carboxylic Acid No suppilers available for the product. |
| Name | (4S,5R)-2,2,5-Trimethyl-1,3-Dioxolane-4-Carboxylic Acid |
|---|---|
| Synonyms | (4S,5R)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 |
| CAS Registry Number | 152786-08-8 |
| SMILES | C[C@@H]1[C@H](OC(O1)(C)C)C(=O)O |
| InChI | 1S/C7H12O4/c1-4-5(6(8)9)11-7(2,3)10-4/h4-5H,1-3H3,(H,8,9)/t4-,5+/m1/s1 |
| InChIKey | HNLGBHQJNORDKW-UHNVWZDZSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.647°C at 760 mmHg (Cal.) |
| Flash point | 98.993°C (Cal.) |
| Refractive index | 1.439 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4S,5R)-2,2,5-Trimethyl-1,3-Dioxolane-4-Carboxylic Acid |