|
CAS#: 153-39-9 Product: 8,9,10,11-Tetrahydronaphtho[5,6-b]Phenanthrene No suppilers available for the product. |
| Name | 8,9,10,11-Tetrahydronaphtho[5,6-b]Phenanthrene |
|---|---|
| Synonyms | Ccris 1281; Dibenz(A,H)Anthracene, 1,2,3,4-Tetrahydro-; 1,2,3,4-Tetrahydrodibenz[A,H]Anthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 153-39-9 |
| SMILES | C2=C1C5=C(C=CC1=CC3=C2C=CC4=C3CCCC4)C=CC=C5 |
| InChI | 1S/C22H18/c1-3-7-19-15(5-1)9-11-17-14-22-18(13-21(17)19)12-10-16-6-2-4-8-20(16)22/h1,3,5,7,9-14H,2,4,6,8H2 |
| InChIKey | UYKUFJXADUOEKW-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.931°C at 760 mmHg (Cal.) |
| Flash point | 256.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9,10,11-Tetrahydronaphtho[5,6-b]Phenanthrene |