|
CAS#: 153-88-8 Product: DL-Tryptophan Mustard No suppilers available for the product. |
| Name | DL-Tryptophan Mustard |
|---|---|
| Synonyms | 2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-1H-Indol-3-Yl]Propionic Acid; Mp 955; Tryptophan Mustard |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 |
| CAS Registry Number | 153-88-8 |
| SMILES | C1=C(N(CCCl)CCCl)C=CC2=C1C(=C[NH]2)CC(C(O)=O)N |
| InChI | 1S/C15H19Cl2N3O2/c16-3-5-20(6-4-17)11-1-2-14-12(8-11)10(9-19-14)7-13(18)15(21)22/h1-2,8-9,13,19H,3-7,18H2,(H,21,22) |
| InChIKey | DGRNTPAKIUYGJI-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.026°C at 760 mmHg (Cal.) |
| Flash point | 300.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-Tryptophan Mustard |