|
CAS#: 15302-12-2 Product: Dimelazine No suppilers available for the product. |
| Name | Dimelazine |
|---|---|
| Synonyms | 10-[(1,3-Dimethyl-3-Pyrrolidinyl)Methyl]Phenothiazine; 10-((1,3-Dimethyl-3-Pyrrolidinyl)Methyl)Phenothiazine.; Dimelazine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.46 |
| CAS Registry Number | 15302-12-2 |
| SMILES | C1=CC=CC3=C1N(C2=C(C=CC=C2)S3)CC4(CN(C)CC4)C |
| InChI | 1S/C19H22N2S/c1-19(11-12-20(2)13-19)14-21-15-7-3-5-9-17(15)22-18-10-6-4-8-16(18)21/h3-10H,11-14H2,1-2H3 |
| InChIKey | VRKHTAYPELFGPP-UHFFFAOYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.447°C at 760 mmHg (Cal.) |
| Flash point | 214.732°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimelazine |