|
CAS#: 153145-01-8 Product: 4-[(3R,4S)-4-(4-Hydroxyphenyl)-3-hexanyl]phenol - 1H-diazirene (1:1) No suppilers available for the product. |
| Name | 4-[(3R,4S)-4-(4-Hydroxyphenyl)-3-hexanyl]phenol - 1H-diazirene (1:1) |
|---|---|
| Synonyms | hexestrol diazirine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 |
| CAS Registry Number | 153145-01-8 |
| SMILES | Oc1ccc(cc1)[C@H](CC)[C@H](CC)c2ccc(O)cc2.C=1NN=1 |
| InChI | 1S/C18H22O2.CH2N2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;1-2-3-1/h5-12,17-20H,3-4H2,1-2H3;1H,(H,2,3)/t17-,18+; |
| InChIKey | VTIFHLSBZIJRPZ-GNXQHMNLSA-N |
| Boiling point | 453.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 227.8°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(3R,4S)-4-(4-Hydroxyphenyl)-3-hexanyl]phenol - 1H-diazirene (1:1) |