Online Database of Chemicals from Around the World
|
CAS#: 153312-17-5 Product: 1-Ethyl-2-(4-Methoxyphenyl)-3-Methyl-1H-Inden-5-Ol No suppilers available for the product. |
| Name | 1-Ethyl-2-(4-Methoxyphenyl)-3-Methyl-1H-Inden-5-Ol |
|---|---|
| Synonyms | 4'-Me-Indenestrol B; Indenestrol B 4'-Monomethyl Ether; (S)-1-Ethyl-2-(4-Methoxyphenyl)-3-Methyl-1H-Inden-5-Ol |
| Molecular Structure |  |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 153312-17-5 |
| SMILES | C1=C(O)C=CC2=C1C(=C(C2CC)C3=CC=C(OC)C=C3)C |
| InChI | 1S/C19H20O2/c1-4-16-17-10-7-14(20)11-18(17)12(2)19(16)13-5-8-15(21-3)9-6-13/h5-11,16,20H,4H2,1-3H3 |
| InChIKey | FGRCYLHFMCPLBF-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.848°C at 760 mmHg (Cal.) |
| Flash point | 229.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-2-(4-Methoxyphenyl)-3-Methyl-1H-Inden-5-Ol |