Online Database of Chemicals from Around the World
| Name | 1,1'-Iminobis(2,3,4,5,6-Pentafluorobenzene) |
|---|---|
| Synonyms | Bis(2,3,4,5,6-Pentafluorophenyl)Amine; Benzenamine, 2,3,4,5,6-Pentafluoro-N-(Pentafluorophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C12HF10N |
| Molecular Weight | 349.13 |
| CAS Registry Number | 1535-92-8 |
| SMILES | C1(=C(F)C(=C(C(=C1F)F)F)F)NC2=C(F)C(=C(C(=C2F)F)F)F |
| InChI | 1S/C12HF10N/c13-1-3(15)7(19)11(8(20)4(1)16)23-12-9(21)5(17)2(14)6(18)10(12)22/h23H |
| InChIKey | NHPXUJAURHKKGX-UHFFFAOYSA-N |
| Density | 1.767g/cm3 (Cal.) |
|---|---|
| Boiling point | 142.319°C at 760 mmHg (Cal.) |
| Flash point | 39.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Iminobis(2,3,4,5,6-Pentafluorobenzene) |
