|
CAS#: 15372-34-6 Product: Doisynoestrol No suppilers available for the product. |
| Name | Doisynoestrol |
|---|---|
| Synonyms | 1-Ethyl-2-Methyl-7-Methoxy-1,2,3,4-Tetrahydrophenanthryl-2-Carboxylic Acid; 16,17-Seco-13-Alpha-Estra-1,3,5,7,9-Pentaen-17-Oic Acid, 3-Methoxy-, (+-)-; 16,17-Seco-13Alpha-Estra-1,3,5,7,9-Pentaen-17-Oic Acid, 3-Methoxy-, (+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 15372-34-6 |
| SMILES | C1=C3C(=CC=C1OC)C2=C(C(C(C(=O)O)(CC2)C)CC)C=C3 |
| InChI | 1S/C19H22O3/c1-4-17-16-7-5-12-11-13(22-3)6-8-14(12)15(16)9-10-19(17,2)18(20)21/h5-8,11,17H,4,9-10H2,1-3H3,(H,20,21) |
| InChIKey | HZZSXUIUESWVSS-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.993°C at 760 mmHg (Cal.) |
| Flash point | 172.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Doisynoestrol |