|
CAS#: 153923-34-3 Product: (1R)-2-Hydroxybicyclo[2.2.1]Hept-5-Ene-2-Carboxylic Acid No suppilers available for the product. |
| Name | (1R)-2-Hydroxybicyclo[2.2.1]Hept-5-Ene-2-Carboxylic Acid |
|---|---|
| Synonyms | (1R)-2-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 |
| CAS Registry Number | 153923-34-3 |
| SMILES | O=C(O)C1(O)CC2/C=C\[C@H]1C2 |
| InChI | 1S/C8H10O3/c9-7(10)8(11)4-5-1-2-6(8)3-5/h1-2,5-6,11H,3-4H2,(H,9,10)/t5?,6-,8?/m0/s1 |
| InChIKey | JSMFWZNMLQZDHK-PIJYJLRNSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.75°C at 760 mmHg (Cal.) |
| Flash point | 170.456°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R)-2-Hydroxybicyclo[2.2.1]Hept-5-Ene-2-Carboxylic Acid |