Online Database of Chemicals from Around the World
|
CAS#: 15402-27-4 Product: 2,8-Dihydroxy-1,6-dimethoxyxanthone No suppilers available for the product. |
| Name | 2,8-Dihydroxy-1,6-dimethoxyxanthone |
|---|---|
| Synonyms | 2,8-Dihydroxy-1,6-Dimethoxy-Xanthen-9-One; 2,8-Dihydroxy-1,6-Dimethoxy-9-Xanthenone; 2,8-Dihydroxy-1,6-Dimethoxy-Xanthone |
| Molecular Structure |  |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 |
| CAS Registry Number | 15402-27-4 |
| SMILES | C2=C1OC3=C(C(C1=C(C=C2OC)O)=O)C(=C(C=C3)O)OC |
| InChI | 1S/C15H12O6/c1-19-7-5-9(17)12-11(6-7)21-10-4-3-8(16)15(20-2)13(10)14(12)18/h3-6,16-17H,1-2H3 |
| InChIKey | WYOSCUWDVFHQFY-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.35°C at 760 mmHg (Cal.) |
| Flash point | 210.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Dihydroxy-1,6-dimethoxyxanthone |