|
CAS#: 154189-24-9 Product: 4-Hydroxy-7-[2-[2-(3-Phenethyloxypropylsulfonyl)Ethylamino]Ethyl]-3H-1,3-Benzothiazol-2-One Hydrochloride No suppilers available for the product. |
| Name | 4-Hydroxy-7-[2-[2-(3-Phenethyloxypropylsulfonyl)Ethylamino]Ethyl]-3H-1,3-Benzothiazol-2-One Hydrochloride |
|---|---|
| Synonyms | Viozan; Ar-C 68397Aa; Ar-C68397aa |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29ClN2O5S2 |
| Molecular Weight | 501.05 |
| CAS Registry Number | 154189-24-9 |
| SMILES | [H+].C2=CC(=C1NC(SC1=C2CCNCC[S](=O)(=O)CCCOCCC3=CC=CC=C3)=O)O.[Cl-] |
| InChI | 1S/C22H28N2O5S2.ClH/c25-19-8-7-18(21-20(19)24-22(26)30-21)9-11-23-12-16-31(27,28)15-4-13-29-14-10-17-5-2-1-3-6-17;/h1-3,5-8,23,25H,4,9-16H2,(H,24,26);1H |
| InChIKey | YXOKBHUPEBNZOG-UHFFFAOYSA-N |
| Boiling point | 717°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 387.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-7-[2-[2-(3-Phenethyloxypropylsulfonyl)Ethylamino]Ethyl]-3H-1,3-Benzothiazol-2-One Hydrochloride |