|
CAS#: 15426-17-2 Product: 3,3'-Dibromoazobenzene No suppilers available for the product. |
| Name | 3,3'-Dibromoazobenzene |
|---|---|
| Synonyms | Nciopen2_009501; (E)-1,2-Bis(3-Bromophenyl)Diazene; Diazene, Bis(3-Bromophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Br2N2 |
| Molecular Weight | 340.02 |
| CAS Registry Number | 15426-17-2 |
| SMILES | C1=CC=C(Br)C=C1N=NC2=CC(=CC=C2)Br |
| InChI | 1S/C12H8Br2N2/c13-9-3-1-5-11(7-9)15-16-12-6-2-4-10(14)8-12/h1-8H |
| InChIKey | VEVQNDVHZNOSHX-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.272°C at 760 mmHg (Cal.) |
| Flash point | 202.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dibromoazobenzene |