|
CAS#: 154287-01-1 Product: 1-Butyl-1H-Indole-3-Carboxylic Acid No suppilers available for the product. |
| Name | 1-Butyl-1H-Indole-3-Carboxylic Acid |
|---|---|
| Synonyms | 1-Butyl-1H-indole-3-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| CAS Registry Number | 154287-01-1 |
| SMILES | O=C(O)c2c1ccccc1n(c2)CCCC |
| InChI | 1S/C13H15NO2/c1-2-3-8-14-9-11(13(15)16)10-6-4-5-7-12(10)14/h4-7,9H,2-3,8H2,1H3,(H,15,16) |
| InChIKey | FCDUTQOVTAGBSP-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.523°C at 760 mmHg (Cal.) |
| Flash point | 200.868°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Butyl-1H-Indole-3-Carboxylic Acid |