|
CAS#: 15436-35-8 Product: 1,3,4,5-Tetrahydro-1-[(Trichloroacetyl)Imino]-1H,2H-Thiophene No suppilers available for the product. |
| Name | 1,3,4,5-Tetrahydro-1-[(Trichloroacetyl)Imino]-1H,2H-Thiophene |
|---|---|
| Synonyms | 2,2,2-Trichloro-N-(1-Thiolanylidene)Acetamide; 2,2,2-Trichloro-N-(Thiolan-1-Ylidene)Ethanamide; Nsc69834 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Cl3NOS |
| Molecular Weight | 248.55 |
| CAS Registry Number | 15436-35-8 |
| SMILES | O=C(C(Cl)(Cl)Cl)N=[S]1CCCC1 |
| InChI | 1S/C6H8Cl3NOS/c7-6(8,9)5(11)10-12-3-1-2-4-12/h1-4H2 |
| InChIKey | LNBNCOGHHLHNEO-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.931°C at 760 mmHg (Cal.) |
| Flash point | 138.217°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,4,5-Tetrahydro-1-[(Trichloroacetyl)Imino]-1H,2H-Thiophene |