|
CAS#: 15441-97-1 Product: 3-(4-Chloro-2-Methylphenyl)-1,1-Diethylurea No suppilers available for the product. |
| Name | 3-(4-Chloro-2-Methylphenyl)-1,1-Diethylurea |
|---|---|
| Synonyms | 1-(4-chloro-2-methylphenyl)-3,3-diethylurea; N'-(4-Chloro-2-methylphenyl)-N,N-diethylurea; N'-(4-Chloro-2-methylphenyl)-N,N-diethylurea # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 |
| CAS Registry Number | 15441-97-1 |
| SMILES | Clc1cc(c(NC(=O)N(CC)CC)cc1)C |
| InChI | 1S/C12H17ClN2O/c1-4-15(5-2)12(16)14-11-7-6-10(13)8-9(11)3/h6-8H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | OOXWRDYHLKIAKR-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.96°C at 760 mmHg (Cal.) |
| Flash point | 189.641°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chloro-2-Methylphenyl)-1,1-Diethylurea |