|
CAS#: 15444-20-9 Product: Lysicamine No suppilers available for the product. |
| Name | Lysicamine |
|---|---|
| Synonyms | 1,2-Dimethoxy-7H-Dibenzo(De,G)Quinolin-7-One; 5-21-13-00382 (Beilstein Handbook Reference); 7H-Dibenzo(De,G)Quinolin-7-One, 1,2-Dimethoxy- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 |
| CAS Registry Number | 15444-20-9 |
| SMILES | C1=C(C(=C3C2=C1C=CN=C2C(C4=CC=CC=C34)=O)OC)OC |
| InChI | 1S/C18H13NO3/c1-21-13-9-10-7-8-19-16-14(10)15(18(13)22-2)11-5-3-4-6-12(11)17(16)20/h3-9H,1-2H3 |
| InChIKey | DPBMWJXWUINLQT-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.371°C at 760 mmHg (Cal.) |
| Flash point | 261.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysicamine |