|
CAS#: 15448-75-6 Product: 3-Isopropenyl-2,5-Dimethyl-3,4-Hexadien-2-Ol No suppilers available for the product. |
| Name | 3-Isopropenyl-2,5-Dimethyl-3,4-Hexadien-2-Ol |
|---|---|
| Synonyms | 3,4-Hexadien-2-ol, 2,5-dimethyl-3-(1-methylethenyl) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 15448-75-6 |
| SMILES | C(=C(/C)C)=C(\C(=C)C)C(O)(C)C |
| InChI | 1S/C11H18O/c1-8(2)7-10(9(3)4)11(5,6)12/h12H,3H2,1-2,4-6H3 |
| InChIKey | OOYJYXZAXCOHEW-UHFFFAOYSA-N |
| Density | 0.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.204°C at 760 mmHg (Cal.) |
| Flash point | 97.596°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropenyl-2,5-Dimethyl-3,4-Hexadien-2-Ol |