|
CAS#: 154598-58-0 Product: 2-(2-Amino-5-Chlorophenyl)-4-Cyclopropyl-1,1,1-Trifluoro-3-Butyn-2-Ol No suppilers available for the product. |
| Name | 2-(2-Amino-5-Chlorophenyl)-4-Cyclopropyl-1,1,1-Trifluoro-3-Butyn-2-Ol |
|---|---|
| Synonyms | (R)-5-CHL |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClF3NO |
| Molecular Weight | 289.68 |
| CAS Registry Number | 154598-58-0 |
| SMILES | FC(F)(F)C(O)(C#CC1CC1)c2cc(Cl)ccc2N |
| InChI | 1S/C13H11ClF3NO/c14-9-3-4-11(18)10(7-9)12(19,13(15,16)17)6-5-8-1-2-8/h3-4,7-8,19H,1-2,18H2 |
| InChIKey | KEMUGFRERPPUHB-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.052°C at 760 mmHg (Cal.) |
| Flash point | 210.864°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Amino-5-Chlorophenyl)-4-Cyclopropyl-1,1,1-Trifluoro-3-Butyn-2-Ol |