|
CAS#: 15481-68-2 Product: Toluene-2,6-Diamine Monohydrochloride No suppilers available for the product. |
| Name | Toluene-2,6-Diamine Monohydrochloride |
|---|---|
| Synonyms | (3-Amino-2-Methyl-Phenyl)Amine Hydrochloride; Toluene-2,6-Diamine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 |
| CAS Registry Number | 15481-68-2 |
| EINECS | 239-504-2 |
| SMILES | [H+].C1=CC=C(N)C(=C1N)C.[Cl-] |
| InChI | 1S/C7H10N2.ClH/c1-5-6(8)3-2-4-7(5)9;/h2-4H,8-9H2,1H3;1H |
| InChIKey | NHLSZDPFKPSBEW-UHFFFAOYSA-N |
| Boiling point | 284.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 148.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Toluene-2,6-Diamine Monohydrochloride |