|
CAS#: 155-00-0 Product: 2-Chloro-beta-phenylethylhydrazine dihydrogen sulphate No suppilers available for the product. |
| Name | 2-Chloro-beta-phenylethylhydrazine dihydrogen sulphate |
|---|---|
| Synonyms | Hydrazine, (2-(2-Chlorophenyl)Ethyl)-, Sulfate (1:1) (9Ci); Hydrazine, 1-(O-Chlorophenethyl)-, Sulfate (1:1); Wl 27 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13ClN2O4S |
| Molecular Weight | 268.71 |
| CAS Registry Number | 155-00-0 |
| SMILES | C1=C(C(=CC=C1)Cl)CCNN.O=[S](=O)(O)O |
| InChI | 1S/C8H11ClN2.H2O4S/c9-8-4-2-1-3-7(8)5-6-11-10;1-5(2,3)4/h1-4,11H,5-6,10H2;(H2,1,2,3,4) |
| InChIKey | CZWGTSMWFKTQAX-UHFFFAOYSA-N |
| Boiling point | 314.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-beta-phenylethylhydrazine dihydrogen sulphate |