|
CAS#: 15504-42-4 Product: Ethyl N,N-Dimethylphenylalaninate No suppilers available for the product. |
| Name | Ethyl N,N-Dimethylphenylalaninate |
|---|---|
| Synonyms | Ethyl 2-(dimethylamino)-3-phenylpropanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 |
| CAS Registry Number | 15504-42-4 |
| SMILES | O=C(OCC)C(N(C)C)Cc1ccccc1 |
| InChI | 1S/C13H19NO2/c1-4-16-13(15)12(14(2)3)10-11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3 |
| InChIKey | LJIHKWFNOYAMDI-UHFFFAOYSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.209°C at 760 mmHg (Cal.) |
| Flash point | 106.404°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N,N-Dimethylphenylalaninate |