|
CAS#: 15511-81-6 Product: Hexamethylenediamine Adipate No suppilers available for the product. |
| Name | Hexamethylenediamine Adipate |
|---|---|
| Synonyms | 6-Azaniumylhexylammonium; Hexanedioate; 6-Ammoniohexylammonium; Hexanedioate; Adipate; 6-Ammoniohexylammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 |
| CAS Registry Number | 15511-81-6 (52349-42-5) |
| EINECS | 239-539-3 |
| SMILES | C(C([O-])=O)CCCC([O-])=O.C(CCC[NH3+])CC[NH3+] |
| InChI | 1S/C6H16N2.C6H10O4/c7-5-3-1-2-4-6-8;7-5(8)3-1-2-4-6(9)10/h1-8H2;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | UFFRSDWQMJYQNE-UHFFFAOYSA-N |
| Boiling point | 338.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 172.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexamethylenediamine Adipate |