|
CAS#: 155134-38-6 Product: Methyl 7-(Trifluoromethyl)-1H-Indole-3-Carboxylate No suppilers available for the product. |
| Name | Methyl 7-(Trifluoromethyl)-1H-Indole-3-Carboxylate |
|---|---|
| Synonyms | methyl 7-(trifluoromethyl)-1H-indole-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 |
| CAS Registry Number | 155134-38-6 |
| SMILES | FC(F)(F)c1cccc2c1ncc2C(=O)OC |
| InChI | 1S/C11H8F3NO2/c1-17-10(16)7-5-15-9-6(7)3-2-4-8(9)11(12,13)14/h2-5,15H,1H3 |
| InChIKey | AGBQKKMHXAYNCD-UHFFFAOYSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.454°C at 760 mmHg (Cal.) |
| Flash point | 156.073°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 7-(Trifluoromethyl)-1H-Indole-3-Carboxylate |