|
CAS#: 15516-76-4 Product: Mercury Bis(4-Chlorobenzoate) No suppilers available for the product. |
| Name | Mercury Bis(4-Chlorobenzoate) |
|---|---|
| Synonyms | Mercuric 4-Chlorobenzoate; Mercury Bis(4-Chlorobenzoate); Benzoic Acid, 4-Chloro-, Mercury(2+) Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2HgO4 |
| Molecular Weight | 511.71 |
| CAS Registry Number | 15516-76-4 |
| EINECS | 239-548-2 |
| SMILES | C1=C(C([O-])=O)C=CC(=C1)Cl.C2=C(C([O-])=O)C=CC(=C2)Cl.[Hg++] |
| InChI | 1S/2C7H5ClO2.Hg/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4H,(H,9,10);/q;;+2/p-2 |
| InChIKey | WQPHTPYIKIWESZ-UHFFFAOYSA-L |
| Boiling point | 287.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 127.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mercury Bis(4-Chlorobenzoate) |