| Name | 4,4'-Dimethyl-2,2'-Bi(Phenol) |
|---|---|
| Synonyms | 2-(2-Hydroxy-5-Methyl-Phenyl)-4-Methyl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 15519-73-0 |
| SMILES | C1=C(C(=CC(=C1)C)C2=C(C=CC(=C2)C)O)O |
| InChI | 1S/C14H14O2/c1-9-3-5-13(15)11(7-9)12-8-10(2)4-6-14(12)16/h3-8,15-16H,1-2H3 |
| InChIKey | JIONXXHMDHBECT-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.846°C at 760 mmHg (Cal.) |
| Flash point | 159.755°C (Cal.) |
| (1) | Haiyan Cao, Wenbing Shi, Jianxin Xie and Yuming Huang. Highly sensitive and selective fluorescent assay for quantitative detection of divalent copper ion in environmental water samples, Anal. Methods, 2011, 3, 2102. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dimethyl-2,2'-Bi(Phenol) |