|
CAS#: 155522-12-6 Product: Methyl N-{4-[(2-Chloro-4-Nitrophenyl)Diazenyl]-3-(Propionylamino)Phenyl}Alaninate No suppilers available for the product. |
| Name | Methyl N-{4-[(2-Chloro-4-Nitrophenyl)Diazenyl]-3-(Propionylamino)Phenyl}Alaninate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H20ClN5O5 |
| Molecular Weight | 433.85 |
| CAS Registry Number | 155522-12-6 |
| SMILES | CCC(=O)Nc1cc(ccc1N=Nc2ccc(cc2Cl)[N+](=O)[O-])NC(C)C(=O)OC |
| InChI | 1S/C19H20ClN5O5/c1-4-18(26)22-17-9-12(21-11(2)19(27)30-3)5-7-16(17)24-23-15-8-6-13(25(28)29)10-14(15)20/h5-11,21H,4H2,1-3H3,(H,22,26) |
| InChIKey | GGCPAZJYAXHGMU-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 661.772°C at 760 mmHg (Cal.) |
| Flash point | 354.027°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-{4-[(2-Chloro-4-Nitrophenyl)Diazenyl]-3-(Propionylamino)Phenyl}Alaninate |