|
CAS#: 15570-18-0 Product: Phenyl 2-Mercaptobenzoate No suppilers available for the product. |
| Name | Phenyl 2-Mercaptobenzoate |
|---|---|
| Synonyms | 2-Mercaptobenzoic Acid Phenyl Ester; Phenyl 2-Mercaptobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.28 |
| CAS Registry Number | 15570-18-0 |
| EINECS | 239-618-2 |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=C(C=CC=C2)S |
| InChI | 1S/C13H10O2S/c14-13(11-8-4-5-9-12(11)16)15-10-6-2-1-3-7-10/h1-9,16H |
| InChIKey | VPYKTMHVSTXCMB-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.025°C at 760 mmHg (Cal.) |
| Flash point | 279.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 2-Mercaptobenzoate |