|
CAS#: 155990-67-3 Product: (3E)-3-(Nitromethylene)-2-Pentanone No suppilers available for the product. |
| Name | (3E)-3-(Nitromethylene)-2-Pentanone |
|---|---|
| Synonyms | 2-Pentanone, 3-(nitromethylene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 |
| CAS Registry Number | 155990-67-3 |
| SMILES | [O-][N+](=O)\C=C(\C(=O)C)CC |
| InChI | 1S/C6H9NO3/c1-3-6(5(2)8)4-7(9)10/h4H,3H2,1-2H3/b6-4+ |
| InChIKey | GROARPMNTCIURO-GQCTYLIASA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.091°C at 760 mmHg (Cal.) |
| Flash point | 105.096°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3E)-3-(Nitromethylene)-2-Pentanone |