|
CAS#: 156312-11-7 Product: 7,8-Dichloro-9-Methyl-2H-Pyrido[3,4-b]Indol-1-One No suppilers available for the product. |
| Name | 7,8-Dichloro-9-Methyl-2H-Pyrido[3,4-b]Indol-1-One |
|---|---|
| Synonyms | 7,8-Dichloro-9-Methyl-2H-$B-Carbolin-1-One; 1H-Pyrido(3,4-B)Indol-1-One, 7,8-Dichloro-2,9-Dihydro-9-Methyl-; 7,8-Dichloro-2,9-Dihydro-9-Methyl-1H-Pyrido(3,4-B)Indol-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2N2O |
| Molecular Weight | 267.11 |
| CAS Registry Number | 156312-11-7 |
| SMILES | C1=CC(=C(Cl)C2=C1C3=C([N]2C)C(=O)NC=C3)Cl |
| InChI | 1S/C12H8Cl2N2O/c1-16-10-6(2-3-8(13)9(10)14)7-4-5-15-12(17)11(7)16/h2-5H,1H3,(H,15,17) |
| InChIKey | JFESWTBLTSUPGK-UHFFFAOYSA-N |
| Density | 1.564g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.796°C at 760 mmHg (Cal.) |
| Flash point | 288.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Dichloro-9-Methyl-2H-Pyrido[3,4-b]Indol-1-One |