|
CAS#: 156970-98-8 Product: Ethyl (3S,4R)-4-Amino-3-Methoxy-1-Piperidinecarboxylate No suppilers available for the product. |
| Name | Ethyl (3S,4R)-4-Amino-3-Methoxy-1-Piperidinecarboxylate |
|---|---|
| Synonyms | (3S,4R)-ethyl 4-amino-3-methoxypiperidine-1-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 156970-98-8 |
| SMILES | O=C(OCC)N1CC[C@@H](N)[C@@H](OC)C1 |
| InChI | 1S/C9H18N2O3/c1-3-14-9(12)11-5-4-7(10)8(6-11)13-2/h7-8H,3-6,10H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | FIIGTSPAEONQHZ-SFYZADRCSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.254°C at 760 mmHg (Cal.) |
| Flash point | 126.922°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (3S,4R)-4-Amino-3-Methoxy-1-Piperidinecarboxylate |