|
CAS#: 1570-75-8 Product: 2,4-Dichloro-5-Ethyl-3-Methylphenol No suppilers available for the product. |
| Name | 2,4-Dichloro-5-Ethyl-3-Methylphenol |
|---|---|
| Synonyms | 2,4-Dichloro-5-Ethyl-3-Methyl-Phenol; Nci60_011196; Nsc63358 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 |
| CAS Registry Number | 1570-75-8 |
| SMILES | C1=C(C(=C(C(=C1O)Cl)C)Cl)CC |
| InChI | 1S/C9H10Cl2O/c1-3-6-4-7(12)9(11)5(2)8(6)10/h4,12H,3H2,1-2H3 |
| InChIKey | GMHTUWZTSIUNIM-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.526°C at 760 mmHg (Cal.) |
| Flash point | 117.491°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-5-Ethyl-3-Methylphenol |