|
CAS#: 15724-87-5 Product: (alphae)-beta-Chloro-4'-Methoxyacrylophenone No suppilers available for the product. |
| Name | (alphae)-beta-Chloro-4'-Methoxyacrylophenone |
|---|---|
| Synonyms | Trans-3-Chloro-4'-Methoxyacrylophenone; Acrylophenone, 3-Chloro-4'-Methoxy-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 |
| CAS Registry Number | 15724-87-5 |
| SMILES | C1=C(C(\C=C\Cl)=O)C=CC(=C1)OC |
| InChI | 1S/C10H9ClO2/c1-13-9-4-2-8(3-5-9)10(12)6-7-11/h2-7H,1H3/b7-6+ |
| InChIKey | NTFFVFPCZOKKOT-VOTSOKGWSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.869°C at 760 mmHg (Cal.) |
| Flash point | 124.5°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (alphae)-beta-Chloro-4'-Methoxyacrylophenone |