|
CAS#: 15741-91-0 Product: Carbonic Acid 2,4-Dinitrophenyl(Butyl) Ester No suppilers available for the product. |
| Name | Carbonic Acid 2,4-Dinitrophenyl(Butyl) Ester |
|---|---|
| Synonyms | Carbonic Acid Butyl (2,4-Dinitrophenyl) Ester; Nsc 190961; R-10669 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.23 |
| CAS Registry Number | 15741-91-0 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1[N+]([O-])=O)OC(OCCCC)=O |
| InChI | 1S/C11H12N2O7/c1-2-3-6-19-11(14)20-10-5-4-8(12(15)16)7-9(10)13(17)18/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | UKVCWXQPMRARHZ-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.741°C at 760 mmHg (Cal.) |
| Flash point | 184.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbonic Acid 2,4-Dinitrophenyl(Butyl) Ester |