|
CAS#: 15781-73-4 Product: Bis(2,4,6-Trichlorophenyl) Phenylmalonate No suppilers available for the product. |
| Name | Bis(2,4,6-Trichlorophenyl) Phenylmalonate |
|---|---|
| Synonyms | di(2,4,6-trichlorophenyl) 2-phenylmalonate; ZINC02565112 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H10Cl6O4 |
| Molecular Weight | 539.02 |
| CAS Registry Number | 15781-73-4 |
| SMILES | Clc3cc(Cl)cc(Cl)c3OC(=O)C(c1ccccc1)C(=O)Oc2c(Cl)cc(Cl)cc2Cl |
| InChI | 1S/C21H10Cl6O4/c22-11-6-13(24)18(14(25)7-11)30-20(28)17(10-4-2-1-3-5-10)21(29)31-19-15(26)8-12(23)9-16(19)27/h1-9,17H |
| InChIKey | QGYUICGFAYTSJU-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.3°C at 760 mmHg (Cal.) |
| Flash point | 222.703°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,4,6-Trichlorophenyl) Phenylmalonate |