|
CAS#: 15796-04-0 Product: 2,4,4,6,6,8,8-Heptamethyl-1-Nonene No suppilers available for the product. |
| Name | 2,4,4,6,6,8,8-Heptamethyl-1-Nonene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 |
| CAS Registry Number | 15796-04-0 |
| SMILES | C=C(\CC(CC(CC(C)(C)C)(C)C)(C)C)C |
| InChI | 1S/C16H32/c1-13(2)10-15(6,7)12-16(8,9)11-14(3,4)5/h1,10-12H2,2-9H3 |
| InChIKey | UANJDEPRRZDYGA-UHFFFAOYSA-N |
| Density | 0.78g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.215°C at 760 mmHg (Cal.) |
| Flash point | 101.412°C (Cal.) |
| Refractive index | 1.439 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,6,6,8,8-Heptamethyl-1-Nonene |