|
CAS#: 158204-26-3 Product: 5,6-Dimethoxy-2-Methyl-1-Benzofuran-4,7-Dione No suppilers available for the product. |
| Name | 5,6-Dimethoxy-2-Methyl-1-Benzofuran-4,7-Dione |
|---|---|
| Synonyms | 5,6-Dimethoxy-2-Methyl-Benzofuran-4,7-Dione; 5,6-Dimethoxy-2-Methylbenzofuran-4,7-Dione; 5,6-Dimethoxy-2-Methyl-Benzofuran-4,7-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 158204-26-3 |
| SMILES | C1=C(C)OC2=C1C(C(=C(OC)C2=O)OC)=O |
| InChI | 1S/C11H10O5/c1-5-4-6-7(12)10(14-2)11(15-3)8(13)9(6)16-5/h4H,1-3H3 |
| InChIKey | NSQSEKIEVVBLOY-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.569°C at 760 mmHg (Cal.) |
| Flash point | 203.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethoxy-2-Methyl-1-Benzofuran-4,7-Dione |