|
CAS#: 158506-27-5 Product: 2-Fluoro-2-Nitrobicyclo[2.2.1]Heptane No suppilers available for the product. |
| Name | 2-Fluoro-2-Nitrobicyclo[2.2.1]Heptane |
|---|---|
| Synonyms | 2-fluoro-2-nitrobicyclo[2.2.1]heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10FNO2 |
| Molecular Weight | 159.16 |
| CAS Registry Number | 158506-27-5 |
| SMILES | C1CC2CC1CC2([N+](=O)[O-])F |
| InChI | 1S/C7H10FNO2/c8-7(9(10)11)4-5-1-2-6(7)3-5/h5-6H,1-4H2 |
| InChIKey | HCTJUWHSHMGZRH-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 217.262°C at 760 mmHg (Cal.) |
| Flash point | 85.198°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-2-Nitrobicyclo[2.2.1]Heptane |